C9H20N2O4 — CID 103400791
2-amino-3-[3-(2-methoxyethoxy)propoxy]propanamide (PubChem CID 103400791) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-amino-3-[3-(2-methoxyethoxy)propoxy]propanamide.
| Compound Name | 2-amino-3-[3-(2-methoxyethoxy)propoxy]propanamide |
|---|---|
| PubChem CID | 103400791 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-amino-3-[3-(2-methoxyethoxy)propoxy]propanamide |
| SMILES | COCCOCCCOCC(N)C(N)=O |
| InChI | InChI=1S/C9H20N2O4/c1-13-5-6-14-3-2-4-15-7-8(10)9(11)12/h8H,2-7,10H2,1H3,(H2,11,12) |
| InChIKey | KCWSZPSEQOCTPL-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|