C12H25NO3 — CID 106448215
2-(2-methylpropoxy)ethyl (2R)-2-amino-3,3-dimethylbutanoate (PubChem CID 106448215) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl (2R)-2-amino-3,3-dimethylbutanoate.
| Compound Name | 2-(2-methylpropoxy)ethyl (2R)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 106448215 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl (2R)-2-amino-3,3-dimethylbutanoate |
| SMILES | CC(C)COCCOC(=O)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C12H25NO3/c1-9(2)8-15-6-7-16-11(14)10(13)12(3,4)5/h9-10H,6-8,13H2,1-5H3/t10-/m0/s1 |
| InChIKey | KOWJFZHHNZGDPA-JTQLQIEISA-N |
| XLogP | 1.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|