C16H33NO3 — CID 106448205
2-(2-methylpropoxy)ethyl 4-(2-aminoethyl)-5,5-dimethylhexanoate (PubChem CID 106448205) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl 4-(2-aminoethyl)-5,5-dimethylhexanoate.
| Compound Name | 2-(2-methylpropoxy)ethyl 4-(2-aminoethyl)-5,5-dimethylhexanoate |
|---|---|
| PubChem CID | 106448205 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl 4-(2-aminoethyl)-5,5-dimethylhexanoate |
| SMILES | CC(C)COCCOC(=O)CCC(CCN)C(C)(C)C |
| InChI | InChI=1S/C16H33NO3/c1-13(2)12-19-10-11-20-15(18)7-6-14(8-9-17)16(3,4)5/h13-14H,6-12,17H2,1-5H3 |
| InChIKey | KVXAHODWRWGEAU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|