About 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate
2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate (PubChem CID 107837699) has the molecular formula C10H21NO4
and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate.
Molecular Properties
| Compound Name | 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate |
| PubChem CID | 107837699 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate |
| SMILES | CC(C)COCCOC(=O)C(O)CCN |
| InChI | InChI=1S/C10H21NO4/c1-8(2)7-14-5-6-15-10(13)9(12)3-4-11/h8-9,12H,3-7,11H2,1-2H3 |
| InChIKey | FXYSWFAZSHXXTF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate?
The IUPAC name of 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate (CID 107837699) is 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate.
What is the SMILES notation for 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate?
The canonical SMILES for 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate is CC(C)COCCOC(=O)C(O)CCN.
What is the InChIKey of 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate?
The InChIKey is FXYSWFAZSHXXTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4/c1-8(2)7-14-5-6-15-10(13)9(12)3-4-11/h8-9,12H,3-7,11H2,1-2H3.
What are the key properties of 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate?
2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate has a molecular weight of 219.28 g/mol, XLogP of -0.09, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropoxy)ethyl 4-amino-2-hydroxybutanoate is sourced from PubChem (CID 107837699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).