C9H21IN2O3 — CID 173355847
2-(2-methylpropoxy)ethyl N-(2-aminoethyl)carbamate;hydroiodide (PubChem CID 173355847) has the molecular formula C9H21IN2O3 and a molecular weight of 332.18 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl N-(2-aminoethyl)carbamate;hydroiodide.
| Compound Name | 2-(2-methylpropoxy)ethyl N-(2-aminoethyl)carbamate;hydroiodide |
|---|---|
| PubChem CID | 173355847 |
| Molecular Formula | C9H21IN2O3 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl N-(2-aminoethyl)carbamate;hydroiodide |
| SMILES | CC(C)COCCOC(=O)NCCN.I |
| InChI | InChI=1S/C9H20N2O3.HI/c1-8(2)7-13-5-6-14-9(12)11-4-3-10;/h8H,3-7,10H2,1-2H3,(H,11,12);1H |
| InChIKey | VXQVMLQYENRCQG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|