About 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate
2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate (PubChem CID 107019121) has the molecular formula C9H18O4S
and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate |
| PubChem CID | 107019121 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate |
| SMILES | COCCCOCCOC(=O)C(C)S |
| InChI | InChI=1S/C9H18O4S/c1-8(14)9(10)13-7-6-12-5-3-4-11-2/h8,14H,3-7H2,1-2H3 |
| InChIKey | WIFWJHVLBVFZLI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate?
The IUPAC name of 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate (CID 107019121) is 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate.
What is the SMILES notation for 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate?
The canonical SMILES for 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate is COCCCOCCOC(=O)C(C)S.
What is the InChIKey of 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate?
The InChIKey is WIFWJHVLBVFZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4S/c1-8(14)9(10)13-7-6-12-5-3-4-11-2/h8,14H,3-7H2,1-2H3.
What are the key properties of 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate?
2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate has a molecular weight of 222.31 g/mol, XLogP of 0.90, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxypropoxy)ethyl 2-sulfanylpropanoate is sourced from PubChem (CID 107019121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).