C11H22N2O5 — CID 176714971
3-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]propanamide (PubChem CID 176714971) has the molecular formula C11H22N2O5 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]propanamide.
| Compound Name | 3-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 176714971 |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]propanamide |
| SMILES | CC(=O)NCCOCCOCCOCCC(N)=O |
| InChI | InChI=1S/C11H22N2O5/c1-10(14)13-3-5-17-7-9-18-8-6-16-4-2-11(12)15/h2-9H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | YUMALZYBNQYYIO-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|