C15H31N3O5 — CID 158546704
3-(3-acetamidopropoxy)propanamide;4-(3-aminopropoxy)butan-2-one (PubChem CID 158546704) has the molecular formula C15H31N3O5 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-(3-acetamidopropoxy)propanamide;4-(3-aminopropoxy)butan-2-one.
| Compound Name | 3-(3-acetamidopropoxy)propanamide;4-(3-aminopropoxy)butan-2-one |
|---|---|
| PubChem CID | 158546704 |
| Molecular Formula | C15H31N3O5 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 3-(3-acetamidopropoxy)propanamide;4-(3-aminopropoxy)butan-2-one |
| SMILES | CC(=O)CCOCCCN.CC(=O)NCCCOCCC(N)=O |
| InChI | InChI=1S/C8H16N2O3.C7H15NO2/c1-7(11)10-4-2-5-13-6-3-8(9)12;1-7(9)3-6-10-5-2-4-8/h2-6H2,1H3,(H2,9,12)(H,10,11);2-6,8H2,1H3 |
| InChIKey | HPEXNUNCUOURIN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|