C19H36N2O6 — CID 142462796
N-[3-[2-[2-(3-acetamidopropoxy)ethoxy]ethoxy]propyl]-6-oxoheptanamide (PubChem CID 142462796) has the molecular formula C19H36N2O6 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[3-[2-[2-(3-acetamidopropoxy)ethoxy]ethoxy]propyl]-6-oxoheptanamide.
| Compound Name | N-[3-[2-[2-(3-acetamidopropoxy)ethoxy]ethoxy]propyl]-6-oxoheptanamide |
|---|---|
| PubChem CID | 142462796 |
| Molecular Formula | C19H36N2O6 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N-[3-[2-[2-(3-acetamidopropoxy)ethoxy]ethoxy]propyl]-6-oxoheptanamide |
| SMILES | CC(=O)CCCCC(=O)NCCCOCCOCCOCCCNC(C)=O |
| InChI | InChI=1S/C19H36N2O6/c1-17(22)7-3-4-8-19(24)21-10-6-12-26-14-16-27-15-13-25-11-5-9-20-18(2)23/h3-16H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | YJICZTSEDSFTKN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|