About ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine
ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine (PubChem CID 160938078) has the molecular formula C54H156N2O25
and a molecular weight of 1233.83 g/mol. Its IUPAC name is ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine.
Molecular Properties
| Compound Name | ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine |
| PubChem CID | 160938078 |
| Molecular Formula | C54H156N2O25 |
| Molecular Weight | 1233.83 g/mol |
| Exact Mass | 1233.10 |
| IUPAC Name | ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine |
| SMILES | CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCOCCC(N)=O.CCOCCCN |
| InChI | InChI=1S/C5H11NO2.C5H13NO.22C2H6O/c1-2-8-4-3-5(6)7;1-2-7-5-3-4-6;22*1-2-3/h2-4H2,1H3,(H2,6,7);2-6H2,1H3;22*3H,2H2,1H3 |
| InChIKey | SUDFONLSOHQPQG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 532.63 Ų |
| H-Bond Donors | 24 |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 81 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1233.83 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 24 |
| H-Bond Acceptors ≤ 10 | 26 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine?
The IUPAC name of ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine (CID 160938078) is ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine.
What is the SMILES notation for ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine?
The canonical SMILES for ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine is CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCOCCC(N)=O.CCOCCCN.
What is the InChIKey of ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine?
The InChIKey is SUDFONLSOHQPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C5H13NO.22C2H6O/c1-2-8-4-3-5(6)7;1-2-7-5-3-4-6;22*1-2-3/h2-4H2,1H3,(H2,6,7);2-6H2,1H3;22*3H,2H2,1H3.
What are the key properties of ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine?
ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine has a molecular weight of 1233.83 g/mol, XLogP of 0.24, 8 rotatable bonds, 24 hydrogen bond donors, and 26 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;3-ethoxypropanamide;3-ethoxypropan-1-amine is sourced from PubChem (CID 160938078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).