C7H15O4- — CID 23090651
ethanol;3-ethoxypropanoate (PubChem CID 23090651) has the molecular formula C7H15O4- and a molecular weight of 163.19 g/mol. Its IUPAC name is ethanol;3-ethoxypropanoate.
| Compound Name | ethanol;3-ethoxypropanoate |
|---|---|
| PubChem CID | 23090651 |
| Molecular Formula | C7H15O4- |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | ethanol;3-ethoxypropanoate |
| SMILES | CCO.CCOCCC(=O)[O-] |
| InChI | InChI=1S/C5H10O3.C2H6O/c1-2-8-4-3-5(6)7;1-2-3/h2-4H2,1H3,(H,6,7);3H,2H2,1H3/p-1 |
| InChIKey | HIUGPDBZOROEBP-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|