C16H30N2O5 — CID 118645263
3-(2-ethoxyethoxy)propanoate;1-(2-ethoxyethyl)-3-ethylimidazol-1-ium (PubChem CID 118645263) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-(2-ethoxyethoxy)propanoate;1-(2-ethoxyethyl)-3-ethylimidazol-1-ium.
| Compound Name | 3-(2-ethoxyethoxy)propanoate;1-(2-ethoxyethyl)-3-ethylimidazol-1-ium |
|---|---|
| PubChem CID | 118645263 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 3-(2-ethoxyethoxy)propanoate;1-(2-ethoxyethyl)-3-ethylimidazol-1-ium |
| SMILES | CCOCCOCCC(=O)[O-].CCOCC[n+]1ccn(CC)c1 |
| InChI | InChI=1S/C9H17N2O.C7H14O4/c1-3-10-5-6-11(9-10)7-8-12-4-2;1-2-10-5-6-11-4-3-7(8)9/h5-6,9H,3-4,7-8H2,1-2H3;2-6H2,1H3,(H,8,9)/q+1;/p-1 |
| InChIKey | YAWZMHRVBAUXOY-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 76.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|