C14H26N2O4 — CID 170168110
1,3-bis(3-methoxypropyl)imidazol-1-ium;propanoate (PubChem CID 170168110) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1,3-bis(3-methoxypropyl)imidazol-1-ium;propanoate.
| Compound Name | 1,3-bis(3-methoxypropyl)imidazol-1-ium;propanoate |
|---|---|
| PubChem CID | 170168110 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1,3-bis(3-methoxypropyl)imidazol-1-ium;propanoate |
| SMILES | CCC(=O)[O-].COCCCn1cc[n+](CCCOC)c1 |
| InChI | InChI=1S/C11H21N2O2.C3H6O2/c1-14-9-3-5-12-7-8-13(11-12)6-4-10-15-2;1-2-3(4)5/h7-8,11H,3-6,9-10H2,1-2H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | DIAFPXCCHMKGBR-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|