C21H40N2O2 — CID 142550854
1,3-dioctylimidazol-1-ium acetate (PubChem CID 142550854) has the molecular formula C21H40N2O2 and a molecular weight of 352.56 g/mol. Its IUPAC name is 1,3-dioctylimidazol-1-ium acetate.
| Compound Name | 1,3-dioctylimidazol-1-ium acetate |
|---|---|
| PubChem CID | 142550854 |
| Molecular Formula | C21H40N2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 1,3-dioctylimidazol-1-ium acetate |
| SMILES | CC(=O)[O-].CCCCCCCCn1cc[n+](CCCCCCCC)c1 |
| InChI | InChI=1S/C19H37N2.C2H4O2/c1-3-5-7-9-11-13-15-20-17-18-21(19-20)16-14-12-10-8-6-4-2;1-2(3)4/h17-19H,3-16H2,1-2H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | ISXOFOISGKIHMI-UHFFFAOYSA-M |
| XLogP | 4.25 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|