C19H37FN2 — CID 141499000
1,3-dioctylimidazol-1-ium fluoride (PubChem CID 141499000) has the molecular formula C19H37FN2 and a molecular weight of 312.52 g/mol. Its IUPAC name is 1,3-dioctylimidazol-1-ium fluoride.
| Compound Name | 1,3-dioctylimidazol-1-ium fluoride |
|---|---|
| PubChem CID | 141499000 |
| Molecular Formula | C19H37FN2 |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | 1,3-dioctylimidazol-1-ium fluoride |
| SMILES | CCCCCCCCn1cc[n+](CCCCCCCC)c1.[F-] |
| InChI | InChI=1S/C19H37N2.FH/c1-3-5-7-9-11-13-15-20-17-18-21(19-20)16-14-12-10-8-6-4-2;/h17-19H,3-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OJOLTONGBCVKTJ-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|