C15H29BrN2 — CID 13045373
1,3-dihexylimidazol-1-ium bromide (PubChem CID 13045373) has the molecular formula C15H29BrN2 and a molecular weight of 317.32 g/mol. Its IUPAC name is 1,3-dihexylimidazol-1-ium bromide.
| Compound Name | 1,3-dihexylimidazol-1-ium bromide |
|---|---|
| PubChem CID | 13045373 |
| Molecular Formula | C15H29BrN2 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1,3-dihexylimidazol-1-ium bromide |
| SMILES | CCCCCCn1cc[n+](CCCCCC)c1.[Br-] |
| InChI | InChI=1S/C15H29N2.BrH/c1-3-5-7-9-11-16-13-14-17(15-16)12-10-8-6-4-2;/h13-15H,3-12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LSKGVMCYWOQFJO-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|