C17H33IN2O6 — CID 87189348
1,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]imidazol-1-ium iodide (PubChem CID 87189348) has the molecular formula C17H33IN2O6 and a molecular weight of 488.36 g/mol. Its IUPAC name is 1,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]imidazol-1-ium iodide.
| Compound Name | 1,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]imidazol-1-ium iodide |
|---|---|
| PubChem CID | 87189348 |
| Molecular Formula | C17H33IN2O6 |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 1,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]imidazol-1-ium iodide |
| SMILES | COCCOCCOCCn1cc[n+](CCOCCOCCOC)c1.[I-] |
| InChI | InChI=1S/C17H33N2O6.HI/c1-20-9-11-24-15-13-22-7-5-18-3-4-19(17-18)6-8-23-14-16-25-12-10-21-2;/h3-4,17H,5-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XYRHLUUGTNNSDF-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 64.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|