C20H30N6O2+2 — CID 102138076
4-[3-[2-[2-[2-[3-(3-cyanopropyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethyl]imidazol-1-ium-1-yl]butanenitrile (PubChem CID 102138076) has the molecular formula C20H30N6O2+2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-[3-[2-[2-[2-[3-(3-cyanopropyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethyl]imidazol-1-ium-1-yl]butanenitrile.
| Compound Name | 4-[3-[2-[2-[2-[3-(3-cyanopropyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethyl]imidazol-1-ium-1-yl]butanenitrile |
|---|---|
| PubChem CID | 102138076 |
| Molecular Formula | C20H30N6O2+2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-[3-[2-[2-[2-[3-(3-cyanopropyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethyl]imidazol-1-ium-1-yl]butanenitrile |
| SMILES | N#CCCC[n+]1ccn(CCOCCOCCn2cc[n+](CCCC#N)c2)c1 |
| InChI | InChI=1S/C20H30N6O2/c21-5-1-3-7-23-9-11-25(19-23)13-15-27-17-18-28-16-14-26-12-10-24(20-26)8-4-2-6-22/h9-12,19-20H,1-4,7-8,13-18H2/q+2 |
| InChIKey | GYFGDFWNUKVDAJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|