C11H21N2O2+ — CID 59112282
1,3-bis(2-ethoxyethyl)imidazol-1-ium (PubChem CID 59112282) has the molecular formula C11H21N2O2+ and a molecular weight of 213.30 g/mol. Its IUPAC name is 1,3-bis(2-ethoxyethyl)imidazol-1-ium.
| Compound Name | 1,3-bis(2-ethoxyethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 59112282 |
| Molecular Formula | C11H21N2O2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 1,3-bis(2-ethoxyethyl)imidazol-1-ium |
| SMILES | CCOCCn1cc[n+](CCOCC)c1 |
| InChI | InChI=1S/C11H21N2O2/c1-3-14-9-7-12-5-6-13(11-12)8-10-15-4-2/h5-6,11H,3-4,7-10H2,1-2H3/q+1 |
| InChIKey | TUZRFEXRPFPASZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|