C13H25N2O2+ — CID 170169198
1,3-bis(2-propan-2-yloxyethyl)imidazol-1-ium (PubChem CID 170169198) has the molecular formula C13H25N2O2+ and a molecular weight of 241.35 g/mol. Its IUPAC name is 1,3-bis(2-propan-2-yloxyethyl)imidazol-1-ium.
| Compound Name | 1,3-bis(2-propan-2-yloxyethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 170169198 |
| Molecular Formula | C13H25N2O2+ |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 1,3-bis(2-propan-2-yloxyethyl)imidazol-1-ium |
| SMILES | CC(C)OCCn1cc[n+](CCOC(C)C)c1 |
| InChI | InChI=1S/C13H25N2O2/c1-12(2)16-9-7-14-5-6-15(11-14)8-10-17-13(3)4/h5-6,11-13H,7-10H2,1-4H3/q+1 |
| InChIKey | NFJMISCQTZJPNY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|