C26H30F18N4O3+2 — CID 102468051
1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-[2-[2-[2-[2-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]imidazol-1-ium (PubChem CID 102468051) has the molecular formula C26H30F18N4O3+2 and a molecular weight of 788.51 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-[2-[2-[2-[2-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]imidazol-1-ium.
| Compound Name | 1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-[2-[2-[2-[2-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]imidazol-1-ium |
|---|---|
| PubChem CID | 102468051 |
| Molecular Formula | C26H30F18N4O3+2 |
| Molecular Weight | 788.51 g/mol |
| Exact Mass | 788.20 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-[2-[2-[2-[2-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]imidazol-1-ium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[n+]1ccn(CCOCCOCCOCCn2cc[n+](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H30F18N4O3/c27-19(28,21(31,32)23(35,36)25(39,40)41)1-3-45-5-7-47(17-45)9-11-49-13-15-51-16-14-50-12-10-48-8-6-46(18-48)4-2-20(29,30)22(33,34)24(37,38)26(42,43)44/h5-8,17-18H,1-4,9-16H2/q+2 |
| InChIKey | MAAKYHQXPDYTCC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|