C9H11F6N2+ — CID 12964291
1,3-bis(3,3,3-trifluoropropyl)imidazol-1-ium (PubChem CID 12964291) has the molecular formula C9H11F6N2+ and a molecular weight of 261.19 g/mol. Its IUPAC name is 1,3-bis(3,3,3-trifluoropropyl)imidazol-1-ium.
| Compound Name | 1,3-bis(3,3,3-trifluoropropyl)imidazol-1-ium |
|---|---|
| PubChem CID | 12964291 |
| Molecular Formula | C9H11F6N2+ |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 1,3-bis(3,3,3-trifluoropropyl)imidazol-1-ium |
| SMILES | FC(F)(F)CCn1cc[n+](CCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F6N2/c10-8(11,12)1-3-16-5-6-17(7-16)4-2-9(13,14)15/h5-7H,1-4H2/q+1 |
| InChIKey | ZCIVCXXJGHBCOP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|