C12H21F3N2O3S — CID 139468131
1,3-dibutylimidazol-1-ium;trifluoromethanesulfonate (PubChem CID 139468131) has the molecular formula C12H21F3N2O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 1,3-dibutylimidazol-1-ium;trifluoromethanesulfonate.
| Compound Name | 1,3-dibutylimidazol-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139468131 |
| Molecular Formula | C12H21F3N2O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1,3-dibutylimidazol-1-ium;trifluoromethanesulfonate |
| SMILES | CCCCn1cc[n+](CCCC)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H21N2.CHF3O3S/c1-3-5-7-12-9-10-13(11-12)8-6-4-2;2-1(3,4)8(5,6)7/h9-11H,3-8H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | XDOUEBLOZQZEKB-UHFFFAOYSA-M |
| XLogP | 2.43 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|