C15H19F3N2O3S — CID 171853577
1-benzyl-3-butylimidazol-1-ium;trifluoromethanesulfonate (PubChem CID 171853577) has the molecular formula C15H19F3N2O3S and a molecular weight of 364.39 g/mol. Its IUPAC name is 1-benzyl-3-butylimidazol-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-benzyl-3-butylimidazol-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171853577 |
| Molecular Formula | C15H19F3N2O3S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-benzyl-3-butylimidazol-1-ium;trifluoromethanesulfonate |
| SMILES | CCCCn1cc[n+](Cc2ccccc2)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H19N2.CHF3O3S/c1-2-3-9-15-10-11-16(13-15)12-14-7-5-4-6-8-14;2-1(3,4)8(5,6)7/h4-8,10-11,13H,2-3,9,12H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | AXGOLDAAONPISA-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|