C22H32F12N4P2 — CID 139239498
1-butyl-3-[[2-[(3-butylimidazol-1-ium-1-yl)methyl]phenyl]methyl]imidazol-3-ium dihexafluorophosphate (PubChem CID 139239498) has the molecular formula C22H32F12N4P2 and a molecular weight of 642.45 g/mol. Its IUPAC name is 1-butyl-3-[[2-[(3-butylimidazol-1-ium-1-yl)methyl]phenyl]methyl]imidazol-3-ium dihexafluorophosphate.
| Compound Name | 1-butyl-3-[[2-[(3-butylimidazol-1-ium-1-yl)methyl]phenyl]methyl]imidazol-3-ium dihexafluorophosphate |
|---|---|
| PubChem CID | 139239498 |
| Molecular Formula | C22H32F12N4P2 |
| Molecular Weight | 642.45 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 1-butyl-3-[[2-[(3-butylimidazol-1-ium-1-yl)methyl]phenyl]methyl]imidazol-3-ium dihexafluorophosphate |
| SMILES | CCCCn1cc[n+](Cc2ccccc2C[n+]2ccn(CCCC)c2)c1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C22H32N4.2F6P/c1-3-5-11-23-13-15-25(19-23)17-21-9-7-8-10-22(21)18-26-16-14-24(20-26)12-6-4-2;2*1-7(2,3,4,5)6/h7-10,13-16,19-20H,3-6,11-12,17-18H2,1-2H3;;/q+2;2*-1 |
| InChIKey | FJOMEPSRABKYIR-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.45 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|