C32H56N4O6Si2+2 — CID 132558297
triethoxy-[3-[3-[[2-[[3-(3-triethoxysilylpropyl)imidazol-1-ium-1-yl]methyl]phenyl]methyl]imidazol-3-ium-1-yl]propyl]silane (PubChem CID 132558297) has the molecular formula C32H56N4O6Si2+2 and a molecular weight of 648.99 g/mol. Its IUPAC name is triethoxy-[3-[3-[[2-[[3-(3-triethoxysilylpropyl)imidazol-1-ium-1-yl]methyl]phenyl]methyl]imidazol-3-ium-1-yl]propyl]silane.
| Compound Name | triethoxy-[3-[3-[[2-[[3-(3-triethoxysilylpropyl)imidazol-1-ium-1-yl]methyl]phenyl]methyl]imidazol-3-ium-1-yl]propyl]silane |
|---|---|
| PubChem CID | 132558297 |
| Molecular Formula | C32H56N4O6Si2+2 |
| Molecular Weight | 648.99 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | triethoxy-[3-[3-[[2-[[3-(3-triethoxysilylpropyl)imidazol-1-ium-1-yl]methyl]phenyl]methyl]imidazol-3-ium-1-yl]propyl]silane |
| SMILES | CCO[Si](CCCn1cc[n+](Cc2ccccc2C[n+]2ccn(CCC[Si](OCC)(OCC)OCC)c2)c1)(OCC)OCC |
| InChI | InChI=1S/C32H56N4O6Si2/c1-7-37-43(38-8-2,39-9-3)25-15-19-33-21-23-35(29-33)27-31-17-13-14-18-32(31)28-36-24-22-34(30-36)20-16-26-44(40-10-4,41-11-5)42-12-6/h13-14,17-18,21-24,29-30H,7-12,15-16,19-20,25-28H2,1-6H3/q+2 |
| InChIKey | LCGFZLJOTRTQHT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 73.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|