C28H50N2O6Si2+2 — CID 102388742
triethoxy-[3-[4-[1-(3-triethoxysilylpropyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]silane (PubChem CID 102388742) has the molecular formula C28H50N2O6Si2+2 and a molecular weight of 566.89 g/mol. Its IUPAC name is triethoxy-[3-[4-[1-(3-triethoxysilylpropyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]silane.
| Compound Name | triethoxy-[3-[4-[1-(3-triethoxysilylpropyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]silane |
|---|---|
| PubChem CID | 102388742 |
| Molecular Formula | C28H50N2O6Si2+2 |
| Molecular Weight | 566.89 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | triethoxy-[3-[4-[1-(3-triethoxysilylpropyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]silane |
| SMILES | CCO[Si](CCC[n+]1ccc(-c2cc[n+](CCC[Si](OCC)(OCC)OCC)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C28H50N2O6Si2/c1-7-31-37(32-8-2,33-9-3)25-13-19-29-21-15-27(16-22-29)28-17-23-30(24-18-28)20-14-26-38(34-10-4,35-11-5)36-12-6/h15-18,21-24H,7-14,19-20,25-26H2,1-6H3/q+2 |
| InChIKey | QWSRZYVPMCUYGT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|