C19H37ClN2O3Si — CID 19897981
N,N-dibutyl-1-(3-trimethoxysilylpropyl)pyridin-1-ium-4-amine chloride (PubChem CID 19897981) has the molecular formula C19H37ClN2O3Si and a molecular weight of 405.06 g/mol. Its IUPAC name is N,N-dibutyl-1-(3-trimethoxysilylpropyl)pyridin-1-ium-4-amine chloride.
| Compound Name | N,N-dibutyl-1-(3-trimethoxysilylpropyl)pyridin-1-ium-4-amine chloride |
|---|---|
| PubChem CID | 19897981 |
| Molecular Formula | C19H37ClN2O3Si |
| Molecular Weight | 405.06 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N,N-dibutyl-1-(3-trimethoxysilylpropyl)pyridin-1-ium-4-amine chloride |
| SMILES | CCCCN(CCCC)c1cc[n+](CCC[Si](OC)(OC)OC)cc1.[Cl-] |
| InChI | InChI=1S/C19H37N2O3Si.ClH/c1-6-8-14-21(15-9-7-2)19-11-16-20(17-12-19)13-10-18-25(22-3,23-4)24-5;/h11-12,16-17H,6-10,13-15,18H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | ZCRPRHSXDBNGQY-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 34.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.06 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|