N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride

C20H37ClN2 — CID 23165283

IUPACN,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride
SMILESCCCCC(CC)[n+]1ccc(N(CCCC)CCCC)cc1.[Cl-]
InChIInChI=1S/C20H37N2.ClH/c1-5-9-12-19(8-4)22-17-13-20(14-18-22)21(15-10-6-2)16-11-7-3;/h13-14,17-19H,5-12,15-16H2,1-4H3;1H/q+1;/p-1
InChIKeyFSMMBBZQSBRYBS-UHFFFAOYSA-M
MW340.98 g/mol
LogP2.53
Rot. Bonds12

About N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride

N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride (PubChem CID 23165283) has the molecular formula C20H37ClN2 and a molecular weight of 340.98 g/mol. Its IUPAC name is N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride.

Molecular Properties

Compound NameN,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride
PubChem CID23165283
Molecular FormulaC20H37ClN2
Molecular Weight340.98 g/mol
Exact Mass340.26
IUPAC NameN,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride
SMILESCCCCC(CC)[n+]1ccc(N(CCCC)CCCC)cc1.[Cl-]
InChIInChI=1S/C20H37N2.ClH/c1-5-9-12-19(8-4)22-17-13-20(14-18-22)21(15-10-6-2)16-11-7-3;/h13-14,17-19H,5-12,15-16H2,1-4H3;1H/q+1;/p-1
InChIKeyFSMMBBZQSBRYBS-UHFFFAOYSA-M
XLogP2.53
TPSA7.12 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds12
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.98
LogP ≤ 52.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride?
The IUPAC name of N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride (CID 23165283) is N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride.
What is the SMILES notation for N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride?
The canonical SMILES for N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride is CCCCC(CC)[n+]1ccc(N(CCCC)CCCC)cc1.[Cl-].
What is the InChIKey of N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride?
The InChIKey is FSMMBBZQSBRYBS-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H37N2.ClH/c1-5-9-12-19(8-4)22-17-13-20(14-18-22)21(15-10-6-2)16-11-7-3;/h13-14,17-19H,5-12,15-16H2,1-4H3;1H/q+1;/p-1.
What are the key properties of N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride?
N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride has a molecular weight of 340.98 g/mol, XLogP of 2.53, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride is sourced from PubChem (CID 23165283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).