C20H37ClN2 — CID 23165283
N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride (PubChem CID 23165283) has the molecular formula C20H37ClN2 and a molecular weight of 340.98 g/mol. Its IUPAC name is N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride.
| Compound Name | N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride |
|---|---|
| PubChem CID | 23165283 |
| Molecular Formula | C20H37ClN2 |
| Molecular Weight | 340.98 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine chloride |
| SMILES | CCCCC(CC)[n+]1ccc(N(CCCC)CCCC)cc1.[Cl-] |
| InChI | InChI=1S/C20H37N2.ClH/c1-5-9-12-19(8-4)22-17-13-20(14-18-22)21(15-10-6-2)16-11-7-3;/h13-14,17-19H,5-12,15-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FSMMBBZQSBRYBS-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.98 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|