C44H78Br2N4+2 — CID 90091998
1-[1,10-dibromo-10-[4-(dihexylamino)pyridin-1-ium-1-yl]decyl]-N,N-dihexylpyridin-1-ium-4-amine (PubChem CID 90091998) has the molecular formula C44H78Br2N4+2 and a molecular weight of 822.94 g/mol. Its IUPAC name is 1-[1,10-dibromo-10-[4-(dihexylamino)pyridin-1-ium-1-yl]decyl]-N,N-dihexylpyridin-1-ium-4-amine.
| Compound Name | 1-[1,10-dibromo-10-[4-(dihexylamino)pyridin-1-ium-1-yl]decyl]-N,N-dihexylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 90091998 |
| Molecular Formula | C44H78Br2N4+2 |
| Molecular Weight | 822.94 g/mol |
| Exact Mass | 820.46 |
| IUPAC Name | 1-[1,10-dibromo-10-[4-(dihexylamino)pyridin-1-ium-1-yl]decyl]-N,N-dihexylpyridin-1-ium-4-amine |
| SMILES | CCCCCCN(CCCCCC)c1cc[n+](C(Br)CCCCCCCCC(Br)[n+]2ccc(N(CCCCCC)CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C44H78Br2N4/c1-5-9-13-23-33-47(34-24-14-10-6-2)41-29-37-49(38-30-41)43(45)27-21-19-17-18-20-22-28-44(46)50-39-31-42(32-40-50)48(35-25-15-11-7-3)36-26-16-12-8-4/h29-32,37-40,43-44H,5-28,33-36H2,1-4H3/q+2 |
| InChIKey | YMXRIJOPFQSWEO-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.94 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|