C27H44Br2N4+2 — CID 57266967
1-[1,5-dibromo-5-[4-(hexylamino)pyridin-1-ium-1-yl]pentyl]-N-hexylpyridin-1-ium-4-amine (PubChem CID 57266967) has the molecular formula C27H44Br2N4+2 and a molecular weight of 584.49 g/mol. Its IUPAC name is 1-[1,5-dibromo-5-[4-(hexylamino)pyridin-1-ium-1-yl]pentyl]-N-hexylpyridin-1-ium-4-amine.
| Compound Name | 1-[1,5-dibromo-5-[4-(hexylamino)pyridin-1-ium-1-yl]pentyl]-N-hexylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 57266967 |
| Molecular Formula | C27H44Br2N4+2 |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 1-[1,5-dibromo-5-[4-(hexylamino)pyridin-1-ium-1-yl]pentyl]-N-hexylpyridin-1-ium-4-amine |
| SMILES | CCCCCCNc1cc[n+](C(Br)CCCC(Br)[n+]2ccc(NCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C27H42Br2N4/c1-3-5-7-9-18-30-24-14-20-32(21-15-24)26(28)12-11-13-27(29)33-22-16-25(17-23-33)31-19-10-8-6-4-2/h14-17,20-23,26-27H,3-13,18-19H2,1-2H3/p+2 |
| InChIKey | BSEFQONPUQGOBL-UHFFFAOYSA-P |
| XLogP | 7.90 |
| TPSA | 31.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|