C36H62Br2N4+2 — CID 57050606
1-[1,8-dibromo-8-[4-(heptylamino)pyridin-1-ium-1-yl]-3,3,6,6-tetramethyloctyl]-N-heptylpyridin-1-ium-4-amine (PubChem CID 57050606) has the molecular formula C36H62Br2N4+2 and a molecular weight of 710.73 g/mol. Its IUPAC name is 1-[1,8-dibromo-8-[4-(heptylamino)pyridin-1-ium-1-yl]-3,3,6,6-tetramethyloctyl]-N-heptylpyridin-1-ium-4-amine.
| Compound Name | 1-[1,8-dibromo-8-[4-(heptylamino)pyridin-1-ium-1-yl]-3,3,6,6-tetramethyloctyl]-N-heptylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 57050606 |
| Molecular Formula | C36H62Br2N4+2 |
| Molecular Weight | 710.73 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | 1-[1,8-dibromo-8-[4-(heptylamino)pyridin-1-ium-1-yl]-3,3,6,6-tetramethyloctyl]-N-heptylpyridin-1-ium-4-amine |
| SMILES | CCCCCCCNc1cc[n+](C(Br)CC(C)(C)CCC(C)(C)CC(Br)[n+]2ccc(NCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C36H60Br2N4/c1-7-9-11-13-15-23-39-31-17-25-41(26-18-31)33(37)29-35(3,4)21-22-36(5,6)30-34(38)42-27-19-32(20-28-42)40-24-16-14-12-10-8-2/h17-20,25-28,33-34H,7-16,21-24,29-30H2,1-6H3/p+2 |
| InChIKey | ISHPITYLRVJTHE-UHFFFAOYSA-P |
| XLogP | 11.13 |
| TPSA | 31.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.73 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|