C37H64Br2N4+2 — CID 57163172
N-decyl-1-[1,7-dibromo-7-[4-(decylamino)pyridin-1-ium-1-yl]heptyl]pyridin-1-ium-4-amine (PubChem CID 57163172) has the molecular formula C37H64Br2N4+2 and a molecular weight of 724.76 g/mol. Its IUPAC name is N-decyl-1-[1,7-dibromo-7-[4-(decylamino)pyridin-1-ium-1-yl]heptyl]pyridin-1-ium-4-amine.
| Compound Name | N-decyl-1-[1,7-dibromo-7-[4-(decylamino)pyridin-1-ium-1-yl]heptyl]pyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 57163172 |
| Molecular Formula | C37H64Br2N4+2 |
| Molecular Weight | 724.76 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | N-decyl-1-[1,7-dibromo-7-[4-(decylamino)pyridin-1-ium-1-yl]heptyl]pyridin-1-ium-4-amine |
| SMILES | CCCCCCCCCCNc1cc[n+](C(Br)CCCCCC(Br)[n+]2ccc(NCCCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C37H62Br2N4/c1-3-5-7-9-11-13-15-20-28-40-34-24-30-42(31-25-34)36(38)22-18-17-19-23-37(39)43-32-26-35(27-33-43)41-29-21-16-14-12-10-8-6-4-2/h24-27,30-33,36-37H,3-23,28-29H2,1-2H3/p+2 |
| InChIKey | VXIIGKFAUDWEKK-UHFFFAOYSA-P |
| XLogP | 11.80 |
| TPSA | 31.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.76 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|