C20H37N2+ — CID 23165284
N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine (PubChem CID 23165284) has the molecular formula C20H37N2+ and a molecular weight of 305.53 g/mol. Its IUPAC name is N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine.
| Compound Name | N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 23165284 |
| Molecular Formula | C20H37N2+ |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.30 |
| IUPAC Name | N,N-dibutyl-1-heptan-3-ylpyridin-1-ium-4-amine |
| SMILES | CCCCC(CC)[n+]1ccc(N(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C20H37N2/c1-5-9-12-19(8-4)22-17-13-20(14-18-22)21(15-10-6-2)16-11-7-3/h13-14,17-19H,5-12,15-16H2,1-4H3/q+1 |
| InChIKey | AKANOOYCRZLDIC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|