About 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine
1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine (PubChem CID 13306849) has the molecular formula C25H47N2+
and a molecular weight of 375.67 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine.
Molecular Properties
| Compound Name | 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine |
| PubChem CID | 13306849 |
| Molecular Formula | C25H47N2+ |
| Molecular Weight | 375.67 g/mol |
| Exact Mass | 375.37 |
| IUPAC Name | 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine |
| SMILES | CCCCCCN(CCCCCC)c1cc[n+](CC(CC)CCCC)cc1 |
| InChI | InChI=1S/C25H47N2/c1-5-9-12-14-19-27(20-15-13-10-6-2)25-17-21-26(22-18-25)23-24(8-4)16-11-7-3/h17-18,21-22,24H,5-16,19-20,23H2,1-4H3/q+1 |
| InChIKey | JPSOFKGSFQPYOS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine?
The IUPAC name of 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine (CID 13306849) is 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine.
What is the SMILES notation for 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine?
The canonical SMILES for 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine is CCCCCCN(CCCCCC)c1cc[n+](CC(CC)CCCC)cc1.
What is the InChIKey of 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine?
The InChIKey is JPSOFKGSFQPYOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H47N2/c1-5-9-12-14-19-27(20-15-13-10-6-2)25-17-21-26(22-18-25)23-24(8-4)16-11-7-3/h17-18,21-22,24H,5-16,19-20,23H2,1-4H3/q+1.
What are the key properties of 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine?
1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine has a molecular weight of 375.67 g/mol, XLogP of 7.16, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylhexyl)-N,N-dihexylpyridin-1-ium-4-amine is sourced from PubChem (CID 13306849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).