C17H31IN2 — CID 71323910
1-decyl-N,N-dimethylpyridin-1-ium-4-amine iodide (PubChem CID 71323910) has the molecular formula C17H31IN2 and a molecular weight of 390.35 g/mol. Its IUPAC name is 1-decyl-N,N-dimethylpyridin-1-ium-4-amine iodide.
| Compound Name | 1-decyl-N,N-dimethylpyridin-1-ium-4-amine iodide |
|---|---|
| PubChem CID | 71323910 |
| Molecular Formula | C17H31IN2 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-decyl-N,N-dimethylpyridin-1-ium-4-amine iodide |
| SMILES | CCCCCCCCCC[n+]1ccc(N(C)C)cc1.[I-] |
| InChI | InChI=1S/C17H31N2.HI/c1-4-5-6-7-8-9-10-11-14-19-15-12-17(13-16-19)18(2)3;/h12-13,15-16H,4-11,14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | AJPUSADRRRUVNN-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|