C17H31ClN2O — CID 10018560
N,N-dimethyl-1-(nonoxymethyl)pyridin-1-ium-4-amine chloride (PubChem CID 10018560) has the molecular formula C17H31ClN2O and a molecular weight of 314.90 g/mol. Its IUPAC name is N,N-dimethyl-1-(nonoxymethyl)pyridin-1-ium-4-amine chloride.
| Compound Name | N,N-dimethyl-1-(nonoxymethyl)pyridin-1-ium-4-amine chloride |
|---|---|
| PubChem CID | 10018560 |
| Molecular Formula | C17H31ClN2O |
| Molecular Weight | 314.90 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N,N-dimethyl-1-(nonoxymethyl)pyridin-1-ium-4-amine chloride |
| SMILES | CCCCCCCCCOC[n+]1ccc(N(C)C)cc1.[Cl-] |
| InChI | InChI=1S/C17H31N2O.ClH/c1-4-5-6-7-8-9-10-15-20-16-19-13-11-17(12-14-19)18(2)3;/h11-14H,4-10,15-16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | OSGDHWKYSQTOAK-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.90 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|