C12H19ClN2O2 — CID 11807386
1-(pentoxymethyl)pyridin-1-ium-4-carboxamide chloride (PubChem CID 11807386) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 1-(pentoxymethyl)pyridin-1-ium-4-carboxamide chloride.
| Compound Name | 1-(pentoxymethyl)pyridin-1-ium-4-carboxamide chloride |
|---|---|
| PubChem CID | 11807386 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 1-(pentoxymethyl)pyridin-1-ium-4-carboxamide chloride |
| SMILES | CCCCCOC[n+]1ccc(C(N)=O)cc1.[Cl-] |
| InChI | InChI=1S/C12H18N2O2.ClH/c1-2-3-4-9-16-10-14-7-5-11(6-8-14)12(13)15;/h5-8H,2-4,9-10H2,1H3,(H-,13,15);1H |
| InChIKey | BWVCQSNYISNGTC-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|