C20H28N4O2+2 — CID 101399160
1-[8-(4-carbamoylpyridin-1-ium-1-yl)octyl]pyridin-1-ium-4-carboxamide (PubChem CID 101399160) has the molecular formula C20H28N4O2+2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[8-(4-carbamoylpyridin-1-ium-1-yl)octyl]pyridin-1-ium-4-carboxamide.
| Compound Name | 1-[8-(4-carbamoylpyridin-1-ium-1-yl)octyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 101399160 |
| Molecular Formula | C20H28N4O2+2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-[8-(4-carbamoylpyridin-1-ium-1-yl)octyl]pyridin-1-ium-4-carboxamide |
| SMILES | NC(=O)c1cc[n+](CCCCCCCC[n+]2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c21-19(25)17-7-13-23(14-8-17)11-5-3-1-2-4-6-12-24-15-9-18(10-16-24)20(22)26/h7-10,13-16H,1-6,11-12H2,(H2-2,21,22,25,26)/p+2 |
| InChIKey | VNPAJCVANRAVCB-UHFFFAOYSA-P |
| XLogP | 1.50 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|