C18H32BrN2O+ — CID 126959750
1-dodecylpyridin-1-ium-3-carboxamide;hydrobromide (PubChem CID 126959750) has the molecular formula C18H32BrN2O+ and a molecular weight of 372.37 g/mol. Its IUPAC name is 1-dodecylpyridin-1-ium-3-carboxamide;hydrobromide.
| Compound Name | 1-dodecylpyridin-1-ium-3-carboxamide;hydrobromide |
|---|---|
| PubChem CID | 126959750 |
| Molecular Formula | C18H32BrN2O+ |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-dodecylpyridin-1-ium-3-carboxamide;hydrobromide |
| SMILES | Br.CCCCCCCCCCCC[n+]1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C18H30N2O.BrH/c1-2-3-4-5-6-7-8-9-10-11-14-20-15-12-13-17(16-20)18(19)21;/h12-13,15-16H,2-11,14H2,1H3,(H-,19,21);1H/p+1 |
| InChIKey | CCEMFVQKJNTXEZ-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|