C28H44N4O2+2 — CID 10009159
1-[8-[3-(diethylcarbamoyl)pyridin-1-ium-1-yl]octyl]-N,N-diethylpyridin-1-ium-3-carboxamide (PubChem CID 10009159) has the molecular formula C28H44N4O2+2 and a molecular weight of 468.69 g/mol. Its IUPAC name is 1-[8-[3-(diethylcarbamoyl)pyridin-1-ium-1-yl]octyl]-N,N-diethylpyridin-1-ium-3-carboxamide.
| Compound Name | 1-[8-[3-(diethylcarbamoyl)pyridin-1-ium-1-yl]octyl]-N,N-diethylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 10009159 |
| Molecular Formula | C28H44N4O2+2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | 1-[8-[3-(diethylcarbamoyl)pyridin-1-ium-1-yl]octyl]-N,N-diethylpyridin-1-ium-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc[n+](CCCCCCCC[n+]2cccc(C(=O)N(CC)CC)c2)c1 |
| InChI | InChI=1S/C28H44N4O2/c1-5-31(6-2)27(33)25-17-15-21-29(23-25)19-13-11-9-10-12-14-20-30-22-16-18-26(24-30)28(34)32(7-3)8-4/h15-18,21-24H,5-14,19-20H2,1-4H3/q+2 |
| InChIKey | NPVFSPKVXIVKHR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|