C20H35ClN2O — CID 44660229
1-decyl-N,N-diethylpyridin-1-ium-3-carboxamide chloride (PubChem CID 44660229) has the molecular formula C20H35ClN2O and a molecular weight of 354.97 g/mol. Its IUPAC name is 1-decyl-N,N-diethylpyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-decyl-N,N-diethylpyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 44660229 |
| Molecular Formula | C20H35ClN2O |
| Molecular Weight | 354.97 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-decyl-N,N-diethylpyridin-1-ium-3-carboxamide chloride |
| SMILES | CCCCCCCCCC[n+]1cccc(C(=O)N(CC)CC)c1.[Cl-] |
| InChI | InChI=1S/C20H35N2O.ClH/c1-4-7-8-9-10-11-12-13-16-21-17-14-15-19(18-21)20(23)22(5-2)6-3;/h14-15,17-18H,4-13,16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HQODOYCILPRVKG-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.97 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|