C26H47N2O+ — CID 14009536
1-butyl-N,N-dioctylpyridin-1-ium-3-carboxamide (PubChem CID 14009536) has the molecular formula C26H47N2O+ and a molecular weight of 403.68 g/mol. Its IUPAC name is 1-butyl-N,N-dioctylpyridin-1-ium-3-carboxamide.
| Compound Name | 1-butyl-N,N-dioctylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 14009536 |
| Molecular Formula | C26H47N2O+ |
| Molecular Weight | 403.68 g/mol |
| Exact Mass | 403.37 |
| IUPAC Name | 1-butyl-N,N-dioctylpyridin-1-ium-3-carboxamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)c1ccc[n+](CCCC)c1 |
| InChI | InChI=1S/C26H47N2O/c1-4-7-10-12-14-16-22-28(23-17-15-13-11-8-5-2)26(29)25-19-18-21-27(24-25)20-9-6-3/h18-19,21,24H,4-17,20,22-23H2,1-3H3/q+1 |
| InChIKey | DOEWPQGGQKQHST-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|