C21H35NO — CID 533235
4-ethyl-N,N-dihexylbenzamide (PubChem CID 533235) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 4-ethyl-N,N-dihexylbenzamide.
| Compound Name | 4-ethyl-N,N-dihexylbenzamide |
|---|---|
| PubChem CID | 533235 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 4-ethyl-N,N-dihexylbenzamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C21H35NO/c1-4-7-9-11-17-22(18-12-10-8-5-2)21(23)20-15-13-19(6-3)14-16-20/h13-16H,4-12,17-18H2,1-3H3 |
| InChIKey | AZVCSSVCQAOQAZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|