About formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol
formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol (PubChem CID 142267477) has the molecular formula C25H46N2O4
and a molecular weight of 438.65 g/mol. Its IUPAC name is formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol.
Molecular Properties
| Compound Name | formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol |
| PubChem CID | 142267477 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol |
| SMILES | C=O.CCCCCCN(CCCCC)C(=O)c1ccc(CNCCCCO)cc1.CO |
| InChI | InChI=1S/C23H40N2O2.CH4O.CH2O/c1-3-5-7-10-18-25(17-9-6-4-2)23(27)22-14-12-21(13-15-22)20-24-16-8-11-19-26;2*1-2/h12-15,24,26H,3-11,16-20H2,1-2H3;2H,1H3;1H2 |
| InChIKey | NFIAZJDFCBURHT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol?
The IUPAC name of formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol (CID 142267477) is formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol.
What is the SMILES notation for formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol?
The canonical SMILES for formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol is C=O.CCCCCCN(CCCCC)C(=O)c1ccc(CNCCCCO)cc1.CO.
What is the InChIKey of formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol?
The InChIKey is NFIAZJDFCBURHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40N2O2.CH4O.CH2O/c1-3-5-7-10-18-25(17-9-6-4-2)23(27)22-14-12-21(13-15-22)20-24-16-8-11-19-26;2*1-2/h12-15,24,26H,3-11,16-20H2,1-2H3;2H,1H3;1H2.
What are the key properties of formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol?
formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol has a molecular weight of 438.65 g/mol, XLogP of 4.18, 16 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;N-hexyl-4-[(4-hydroxybutylamino)methyl]-N-pentylbenzamide;methanol is sourced from PubChem (CID 142267477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).