C18H31IN2O — CID 10598096
1-dodecylpyridin-1-ium-3-carboxamide iodide (PubChem CID 10598096) has the molecular formula C18H31IN2O and a molecular weight of 418.36 g/mol. Its IUPAC name is 1-dodecylpyridin-1-ium-3-carboxamide iodide.
| Compound Name | 1-dodecylpyridin-1-ium-3-carboxamide iodide |
|---|---|
| PubChem CID | 10598096 |
| Molecular Formula | C18H31IN2O |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-dodecylpyridin-1-ium-3-carboxamide iodide |
| SMILES | CCCCCCCCCCCC[n+]1cccc(C(N)=O)c1.[I-] |
| InChI | InChI=1S/C18H30N2O.HI/c1-2-3-4-5-6-7-8-9-10-11-14-20-15-12-13-17(16-20)18(19)21;/h12-13,15-16H,2-11,14H2,1H3,(H-,19,21);1H |
| InChIKey | DFFXPGWBARZSHM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|