About nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride
nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride (PubChem CID 13430590) has the molecular formula C18H29ClN2O4
and a molecular weight of 372.89 g/mol. Its IUPAC name is nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride.
Molecular Properties
| Compound Name | nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride |
| PubChem CID | 13430590 |
| Molecular Formula | C18H29ClN2O4 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride |
| SMILES | CCCCCCCCCCCC[n+]1cccc(C(=O)O[N+](=O)[O-])c1.[Cl-] |
| InChI | InChI=1S/C18H29N2O4.ClH/c1-2-3-4-5-6-7-8-9-10-11-14-19-15-12-13-17(16-19)18(21)24-20(22)23;/h12-13,15-16H,2-11,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | LBKKJSHJHDJEKV-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 73.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride?
The IUPAC name of nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride (CID 13430590) is nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride.
What is the SMILES notation for nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride?
The canonical SMILES for nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride is CCCCCCCCCCCC[n+]1cccc(C(=O)O[N+](=O)[O-])c1.[Cl-].
What is the InChIKey of nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride?
The InChIKey is LBKKJSHJHDJEKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H29N2O4.ClH/c1-2-3-4-5-6-7-8-9-10-11-14-19-15-12-13-17(16-19)18(21)24-20(22)23;/h12-13,15-16H,2-11,14H2,1H3;1H/q+1;/p-1.
What are the key properties of nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride?
nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride has a molecular weight of 372.89 g/mol, XLogP of 1.25, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitro 1-dodecylpyridin-1-ium-3-carboxylate chloride is sourced from PubChem (CID 13430590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).