C20H26I2N2O4 — CID 18527133
ethyl 1-[4-(3-ethoxycarbonylpyridin-1-ium-1-yl)butyl]pyridin-1-ium-3-carboxylate diiodide (PubChem CID 18527133) has the molecular formula C20H26I2N2O4 and a molecular weight of 612.25 g/mol. Its IUPAC name is ethyl 1-[4-(3-ethoxycarbonylpyridin-1-ium-1-yl)butyl]pyridin-1-ium-3-carboxylate diiodide.
| Compound Name | ethyl 1-[4-(3-ethoxycarbonylpyridin-1-ium-1-yl)butyl]pyridin-1-ium-3-carboxylate diiodide |
|---|---|
| PubChem CID | 18527133 |
| Molecular Formula | C20H26I2N2O4 |
| Molecular Weight | 612.25 g/mol |
| Exact Mass | 612.00 |
| IUPAC Name | ethyl 1-[4-(3-ethoxycarbonylpyridin-1-ium-1-yl)butyl]pyridin-1-ium-3-carboxylate diiodide |
| SMILES | CCOC(=O)c1ccc[n+](CCCC[n+]2cccc(C(=O)OCC)c2)c1.[I-].[I-] |
| InChI | InChI=1S/C20H26N2O4.2HI/c1-3-25-19(23)17-9-7-13-21(15-17)11-5-6-12-22-14-8-10-18(16-22)20(24)26-4-2;;/h7-10,13-16H,3-6,11-12H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | GOHWMYUUDQGVSP-UHFFFAOYSA-L |
| XLogP | -3.90 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.25 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|