C14H21BrN2O5S — CID 134822285
methyl 1-[5-(2-amino-2-oxoethyl)sulfonylpentyl]pyridin-1-ium-3-carboxylate bromide (PubChem CID 134822285) has the molecular formula C14H21BrN2O5S and a molecular weight of 409.30 g/mol. Its IUPAC name is methyl 1-[5-(2-amino-2-oxoethyl)sulfonylpentyl]pyridin-1-ium-3-carboxylate bromide.
| Compound Name | methyl 1-[5-(2-amino-2-oxoethyl)sulfonylpentyl]pyridin-1-ium-3-carboxylate bromide |
|---|---|
| PubChem CID | 134822285 |
| Molecular Formula | C14H21BrN2O5S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | methyl 1-[5-(2-amino-2-oxoethyl)sulfonylpentyl]pyridin-1-ium-3-carboxylate bromide |
| SMILES | COC(=O)c1ccc[n+](CCCCCS(=O)(=O)CC(N)=O)c1.[Br-] |
| InChI | InChI=1S/C14H20N2O5S.BrH/c1-21-14(18)12-6-5-8-16(10-12)7-3-2-4-9-22(19,20)11-13(15)17;/h5-6,8,10H,2-4,7,9,11H2,1H3,(H-,15,17);1H |
| InChIKey | VPTHDDKMQBVSPM-UHFFFAOYSA-N |
| XLogP | -3.16 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|