C39H48N3O6+3 — CID 11650888
ethyl 1-[[3,5-bis[(3-ethoxycarbonylpyridin-1-ium-1-yl)methyl]-2,4,6-triethylphenyl]methyl]pyridin-1-ium-3-carboxylate (PubChem CID 11650888) has the molecular formula C39H48N3O6+3 and a molecular weight of 654.83 g/mol. Its IUPAC name is ethyl 1-[[3,5-bis[(3-ethoxycarbonylpyridin-1-ium-1-yl)methyl]-2,4,6-triethylphenyl]methyl]pyridin-1-ium-3-carboxylate.
| Compound Name | ethyl 1-[[3,5-bis[(3-ethoxycarbonylpyridin-1-ium-1-yl)methyl]-2,4,6-triethylphenyl]methyl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 11650888 |
| Molecular Formula | C39H48N3O6+3 |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | ethyl 1-[[3,5-bis[(3-ethoxycarbonylpyridin-1-ium-1-yl)methyl]-2,4,6-triethylphenyl]methyl]pyridin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1ccc[n+](Cc2c(CC)c(C[n+]3cccc(C(=O)OCC)c3)c(CC)c(C[n+]3cccc(C(=O)OCC)c3)c2CC)c1 |
| InChI | InChI=1S/C39H48N3O6/c1-7-31-34(25-40-19-13-16-28(22-40)37(43)46-10-4)32(8-2)36(27-42-21-15-18-30(24-42)39(45)48-12-6)33(9-3)35(31)26-41-20-14-17-29(23-41)38(44)47-11-5/h13-24H,7-12,25-27H2,1-6H3/q+3 |
| InChIKey | MJZSKRPLRRFQTB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 90.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|